cas: 142137-17-5 — see every product listed under this CAS number, including other names
3-BROMO-5-PHENYLPYRIDINE, 98%, 98% (CAS 142137-17-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118K0V-100mg |
| cas | 142137-17-5 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 616.40 Pln | |
| Chemat | 25g | 2627.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-bromo-5-phenylpyridine (CAS 142137-17-5) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 3-bromo-5-phenylpyridine. InChIKey: AWCQJXPOCRXHNK-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 3-bromo-5-phenylpyridine |
| InChIKey | AWCQJXPOCRXHNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)