cas: 88280-58-4 — see every product listed under this CAS number, including other names
3-BROMO-N-PHENYLANILINE, 97% (CAS 88280-58-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F852473-250MG |
| cas | 88280-58-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 607.10 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-N-phenylaniline (CAS 88280-58-4) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 3-bromo-N-phenylaniline. InChIKey: IXTBFWCKFRFDOO-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 3-bromo-N-phenylaniline |
| InChIKey | IXTBFWCKFRFDOO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)