Products 301220-81-5
CAS 301220-81-5 appears in our catalog under these names: 3-Benzyl-5-bromopyridine, 3-Benzyl-5-bromopyridine, 95%, 3-Benzyl-5-bromopyridine, 97%, 3-Benzyl-5-bromopyridine 97%, 3-Benzyl-5-bromopyridine, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
3-benzyl-5-bromopyridine (CAS 301220-81-5) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 3-benzyl-5-bromopyridine. InChIKey: YKFQWSDTFGYJKJ-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 3-benzyl-5-bromopyridine |
| InChIKey | YKFQWSDTFGYJKJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)