CAS 5455-13-0 appears in our catalog under these names: 5-Bromo[1,1'-biphenyl]-2-ylamine, 95%, 4-Bromo-2-phenylaniline, 95%, 95%, 4-Bromo-2-phenylaniline. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 250mg, 1g, 100mg.
4-bromo-2-phenylaniline (CAS 5455-13-0) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 4-bromo-2-phenylaniline. InChIKey: QNZCSSKDCUYENG-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 4-bromo-2-phenylaniline |
| InChIKey | QNZCSSKDCUYENG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)Br)N |
Computed by PubChem (NCBI)