CAS 62532-98-3 appears in our catalog under these names: 2-(4-bromophenyl)aniline, 98%, 4'–Bromo–(1,1'–biphenyl)–2–amine, 4'-Bromo-[1,1'-biphenyl]-2-amine 97%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-(4-bromophenyl)aniline (CAS 62532-98-3) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 2-(4-bromophenyl)aniline. InChIKey: UTCNKGRSWYBETH-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 2-(4-bromophenyl)aniline |
| InChIKey | UTCNKGRSWYBETH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)