CAS 88345-94-2 appears in our catalog under these names: 5-Bromo-2-o-tolylpyridine, 95%, 5-Bromo-2-o-tolylpyridine, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g.
5-bromo-2-(2-methylphenyl)pyridine (CAS 88345-94-2) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 5-bromo-2-(2-methylphenyl)pyridine. InChIKey: QKYDTWSRQURVQZ-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 5-bromo-2-(2-methylphenyl)pyridine |
| InChIKey | QKYDTWSRQURVQZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)