CAS 88280-58-4 appears in our catalog under these names: 3-Bromodiphenylamine, 96%, 3-Bromo-N-phenylaniline 98%, 3-Bromo-N-phenylbenzenamine, 98%, 98%, 3-BROMO-N-PHENYLANILINE, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 10g, 1g, 250mg.
3-bromo-N-phenylaniline (CAS 88280-58-4) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 3-bromo-N-phenylaniline. InChIKey: IXTBFWCKFRFDOO-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 3-bromo-N-phenylaniline |
| InChIKey | IXTBFWCKFRFDOO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)