CAS 41738-70-9 appears in our catalog under these names: 3-Bromo-biphenyl-4-ylamine, 95%, 3-Bromo-(1,1'-biphenyl)-4-amine, 98%, 3-Bromo-[1,1'-biphenyl]-4-amine, 98%, 98%, 3-Bromo-[1,1'-biphenyl]-4-amine, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-bromo-4-phenylaniline (CAS 41738-70-9) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 2-bromo-4-phenylaniline. InChIKey: NUMYOKLDZQAXAJ-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 2-bromo-4-phenylaniline |
| InChIKey | NUMYOKLDZQAXAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)N)Br |
Computed by PubChem (NCBI)