cas: 13438-50-1 — see every product listed under this CAS number, including other names
3-BROMOFLUORANTHENE, 95%, 95% (CAS 13438-50-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149Y4-1g |
| cas | 13438-50-1 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 208.40 Pln | |
| Chemat | 25g | 424.40 Pln | |
| Chemat | 100g | 1504.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-bromofluoranthene (CAS 13438-50-1) is a chemical compound with the molecular formula C16H9Br and a molecular weight of 281.15 g/mol. IUPAC name: 3-bromofluoranthene. InChIKey: WCXFCLXZMIFHBU-UHFFFAOYSA-N.
| Molecular formula | C16H9Br |
|---|---|
| Molecular weight | 281.15 g/mol |
| IUPAC name | 3-bromofluoranthene |
| InChIKey | WCXFCLXZMIFHBU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C4C2=CC=CC4=C(C=C3)Br |
Computed by PubChem (NCBI)