cas: 13438-50-1 — see every product listed under this CAS number, including other names
3-Bromofluoranthene, >98.0%(GC) (CAS 13438-50-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B4599-1G |
| cas | 13438-50-1 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 192.10 Pln | |
| TCI | 5g | 610.07 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
3-bromofluoranthene (CAS 13438-50-1) is a chemical compound with the molecular formula C16H9Br and a molecular weight of 281.15 g/mol. IUPAC name: 3-bromofluoranthene. InChIKey: WCXFCLXZMIFHBU-UHFFFAOYSA-N.
| Molecular formula | C16H9Br |
|---|---|
| Molecular weight | 281.15 g/mol |
| IUPAC name | 3-bromofluoranthene |
| InChIKey | WCXFCLXZMIFHBU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C4C2=CC=CC4=C(C=C3)Br |
Computed by PubChem (NCBI)