3-Bromofluoranthene, 95%
cas: 13438-50-1 — see every product listed under this CAS number, including other names
3-Bromofluoranthene, 95% (CAS 13438-50-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A137668-1g |
| cas | 13438-50-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 437.12 Pln | |
| Ambeed | 25g | 559.50 Pln | |
| Ambeed | 100g | 2011.31 Pln | |
| Ambeed | 500g | 7840.81 Pln | |
| BLDpharm | 1g | 131.09 Pln | |
| BLDpharm | 5g | 269.93 Pln | |
| BLDpharm | 10g | 464.31 Pln | |
| BLDpharm | 25g | 597.59 Pln | |
| BLDpharm | 100g | 2163.71 Pln | |
| BLDpharm | 500g | 8444.83 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-bromofluoranthene (CAS 13438-50-1) is a chemical compound with the molecular formula C16H9Br and a molecular weight of 281.15 g/mol. IUPAC name: 3-bromofluoranthene. InChIKey: WCXFCLXZMIFHBU-UHFFFAOYSA-N.
| Molecular formula | C16H9Br |
|---|---|
| Molecular weight | 281.15 g/mol |
| IUPAC name | 3-bromofluoranthene |
| InChIKey | WCXFCLXZMIFHBU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C4C2=CC=CC4=C(C=C3)Br |
Computed by PubChem (NCBI)