cas: 401828-76-0 — see every product listed under this CAS number, including other names
3-Benzamido-4-methylbenzoic acid, 97%, 97% (CAS 401828-76-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11JCVR-250mg |
| cas | 401828-76-0 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 731.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-benzamido-4-methylbenzoic acid (CAS 401828-76-0) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: 3-benzamido-4-methylbenzoic acid. InChIKey: CYXPYFDVSXZFNX-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 3-benzamido-4-methylbenzoic acid |
| InChIKey | CYXPYFDVSXZFNX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)