CAS 855756-90-0 appears in our catalog under these names: 2'-Acetamidobiphenyl-3-carboxylic acid, 98%, 2'-Acetamido-(1,1'-biphenyl)-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-(2-acetamidophenyl)benzoic acid (CAS 855756-90-0) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: 3-(2-acetamidophenyl)benzoic acid. InChIKey: VFGSKBFJJVRRQN-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 3-(2-acetamidophenyl)benzoic acid |
| InChIKey | VFGSKBFJJVRRQN-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC=C1C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)