cas: 41738-70-9 — see every product listed under this CAS number, including other names
3-Bromo-[1,1'-biphenyl]-4-amine, 98% (CAS 41738-70-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F667919-100MG |
| cas | 41738-70-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 778.91 Pln | |
| Fluorochem | 250mg | 966.34 Pln | |
| Fluorochem | 1g | 1596.33 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-4-phenylaniline (CAS 41738-70-9) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 2-bromo-4-phenylaniline. InChIKey: NUMYOKLDZQAXAJ-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 2-bromo-4-phenylaniline |
| InChIKey | NUMYOKLDZQAXAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)N)Br |
Computed by PubChem (NCBI)