cas: 352535-84-3 — see every product listed under this CAS number, including other names
3-Bromo-2,6-difluorophenylboronic acid, 98%, 98% (CAS 352535-84-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118ECQ-100mg |
| cas | 352535-84-3 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 5g | 294.80 Pln | |
| Chemat | 10g | 443.60 Pln | |
| Chemat | 25g | 808.40 Pln | |
| Chemat | 100g | 2104.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3-bromo-2,6-difluorophenyl)boronic acid (CAS 352535-84-3) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (3-bromo-2,6-difluorophenyl)boronic acid. InChIKey: IOPHTXLBAFNMMI-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (3-bromo-2,6-difluorophenyl)boronic acid |
| InChIKey | IOPHTXLBAFNMMI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)Br)F)(O)O |
Computed by PubChem (NCBI)