cas: 1227605-02-8 — see every product listed under this CAS number, including other names
3-Bromo-2-(trifluoromethyl)benzoic acid, 98% (CAS 1227605-02-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A444518-100mg |
| cas | 1227605-02-8 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 480.13 Pln | |
| AmBeed | 10g | 5909.47 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-bromo-2-(trifluoromethyl)benzoic acid (CAS 1227605-02-8) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: 3-bromo-2-(trifluoromethyl)benzoic acid. InChIKey: PZGTYJFUVHSNLB-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | 3-bromo-2-(trifluoromethyl)benzoic acid |
| InChIKey | PZGTYJFUVHSNLB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)