cas: 1214372-19-6 — see every product listed under this CAS number, including other names
3-Bromo-2-fluorobenzene-1-sulfonyl chloride 98% (CAS 1214372-19-6) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A282052-100g |
| cas | 1214372-19-6 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 10877.94 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 798.69 Pln | |
| Ambeed | 25g | 3446.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A282052 |
3-bromo-2-fluorobenzenesulfonyl chloride (CAS 1214372-19-6) is a chemical compound with the molecular formula C6H3BrClFO2S and a molecular weight of 273.51 g/mol. IUPAC name: 3-bromo-2-fluorobenzenesulfonyl chloride. InChIKey: HCIVRVSTKMVMGM-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClFO2S |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 3-bromo-2-fluorobenzenesulfonyl chloride |
| InChIKey | HCIVRVSTKMVMGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)