cas: 1214372-19-6 — see every product listed under this CAS number, including other names
3-Bromo-2-fluorobenzenesulfonyl chloride, 95% (CAS 1214372-19-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F070593-250MG |
| cas | 1214372-19-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 758.08 Pln | |
| Fluorochem | 25g | 3215.55 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-2-fluorobenzenesulfonyl chloride (CAS 1214372-19-6) is a chemical compound with the molecular formula C6H3BrClFO2S and a molecular weight of 273.51 g/mol. IUPAC name: 3-bromo-2-fluorobenzenesulfonyl chloride. InChIKey: HCIVRVSTKMVMGM-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClFO2S |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 3-bromo-2-fluorobenzenesulfonyl chloride |
| InChIKey | HCIVRVSTKMVMGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)