Products 351003-51-5

CAS 351003-51-5 appears in our catalog under these names: 4-Bromo-3-fluorobenzenesulfonyl chloride, 98%, 4–Bromo–3–fluorobenzenesulfonyl Chloride, 4-Bromo-3-fluorobenzenesulfonyl Chloride, >98.0%(GC)(T), 4-Bromo-3-fluorobenzenesulfonyl chloride 98%, 4-Bromo-3-fluorobenzenesulfonyl chloride, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

4-bromo-3-fluorobenzenesulfonyl chloride (CAS 351003-51-5) is a chemical compound with the molecular formula C6H3BrClFO2S and a molecular weight of 273.51 g/mol. IUPAC name: 4-bromo-3-fluorobenzenesulfonyl chloride. InChIKey: IZCXVIACMHTZNA-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3BrClFO2S
Molecular weight273.51 g/mol
IUPAC name4-bromo-3-fluorobenzenesulfonyl chloride
InChIKeyIZCXVIACMHTZNA-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1S(=O)(=O)Cl)F)Br

Computed by PubChem (NCBI)