CAS 771-67-5 is the registry number for 2-Bromo-5-fluorobenzene-1-sulfonyl chloride, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 100g, 25g, 10g, 1g.
2-bromo-5-fluorobenzenesulfonyl chloride (CAS 771-67-5) is a chemical compound with the molecular formula C6H3BrClFO2S and a molecular weight of 273.51 g/mol. IUPAC name: 2-bromo-5-fluorobenzenesulfonyl chloride. InChIKey: JUJFSUADOZWKSR-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClFO2S |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 2-bromo-5-fluorobenzenesulfonyl chloride |
| InChIKey | JUJFSUADOZWKSR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)