Products 771-67-5

CAS 771-67-5 is the registry number for 2-Bromo-5-fluorobenzene-1-sulfonyl chloride, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 100g, 25g, 10g, 1g.

Structural formula: {0} (CAS {1})

2-bromo-5-fluorobenzenesulfonyl chloride (CAS 771-67-5) is a chemical compound with the molecular formula C6H3BrClFO2S and a molecular weight of 273.51 g/mol. IUPAC name: 2-bromo-5-fluorobenzenesulfonyl chloride. InChIKey: JUJFSUADOZWKSR-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3BrClFO2S
Molecular weight273.51 g/mol
IUPAC name2-bromo-5-fluorobenzenesulfonyl chloride
InChIKeyJUJFSUADOZWKSR-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)S(=O)(=O)Cl)Br

Computed by PubChem (NCBI)