CAS 1214372-19-6 appears in our catalog under these names: 3-Bromo-2-fluorobenzenesulfonylchloride, 95%, 3–Bromo–2–fluorobenzene–1–sulfonyl chloride, 3-Bromo-2-fluorobenzenesulfonyl chloride, 3-Bromo-2-fluorobenzenesulfonyl chloride, 97%, 3-Bromo-2-fluorobenzene-1-sulfonyl chloride, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g, 100g.
3-bromo-2-fluorobenzenesulfonyl chloride (CAS 1214372-19-6) is a chemical compound with the molecular formula C6H3BrClFO2S and a molecular weight of 273.51 g/mol. IUPAC name: 3-bromo-2-fluorobenzenesulfonyl chloride. InChIKey: HCIVRVSTKMVMGM-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClFO2S |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 3-bromo-2-fluorobenzenesulfonyl chloride |
| InChIKey | HCIVRVSTKMVMGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)