CAS 1065076-31-4 is the registry number for 2-Bromo-3-fluorobenzenesulphonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-bromo-3-fluorobenzenesulfonyl chloride (CAS 1065076-31-4) is a chemical compound with the molecular formula C6H3BrClFO2S and a molecular weight of 273.51 g/mol. IUPAC name: 2-bromo-3-fluorobenzenesulfonyl chloride. InChIKey: YZXLEQLNBFIGRR-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClFO2S |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 2-bromo-3-fluorobenzenesulfonyl chloride |
| InChIKey | YZXLEQLNBFIGRR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)S(=O)(=O)Cl)Br)F |
Computed by PubChem (NCBI)