CAS 351003-45-7 appears in our catalog under these names: 2-Bromo-4-fluorobenzenesulfonyl chloride, 97%, 2–Bromo–4–fluorobenzenesulfonyl chloride, 2-Bromo-4-fluorobenzenesulfonyl chloride, 97% , 2-Bromo-4-fluorobenzenesulfonyl chloride, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Fluorochem, Ambeed. Available pack sizes: 100g, 25g, 500g, 5g, 1g.
2-bromo-4-fluorobenzenesulfonyl chloride (CAS 351003-45-7) is a chemical compound with the molecular formula C6H3BrClFO2S and a molecular weight of 273.51 g/mol. IUPAC name: 2-bromo-4-fluorobenzenesulfonyl chloride. InChIKey: GJPWPFVLPNTOOL-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClFO2S |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 2-bromo-4-fluorobenzenesulfonyl chloride |
| InChIKey | GJPWPFVLPNTOOL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)