3-Bromo-2-formylbenzoic acid, 97%
cas: 503821-93-0 — see every product listed under this CAS number, including other names
3-Bromo-2-formylbenzoic acid, 97% (CAS 503821-93-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A588884-250mg |
| cas | 503821-93-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1093.50 Pln | |
| Ambeed | 1g | 2806.75 Pln | |
| BLDpharm | 100mg | 714.22 Pln | |
| BLDpharm | 250mg | 1169.61 Pln | |
| BLDpharm | 1g | 3018.96 Pln | |
| Chemat | 100mg | 669.20 Pln | |
| Chemat | 250mg | 1096.40 Pln | |
| Chemat | 1g | 2843.60 Pln | |
| Fluorochem | 100mg | 1237.08 Pln | |
| Fluorochem | 250mg | 2028.47 Pln | |
| Fluorochem | 1g | 5272.12 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
3-bromo-2-formylbenzoic acid (CAS 503821-93-0) is a chemical compound with the molecular formula C8H5BrO3 and a molecular weight of 229.03 g/mol. IUPAC name: 3-bromo-2-formylbenzoic acid. InChIKey: VOVNLLRCBFAQGC-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO3 |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 3-bromo-2-formylbenzoic acid |
| InChIKey | VOVNLLRCBFAQGC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C=O)C(=O)O |
Computed by PubChem (NCBI)