Products 398119-27-2

CAS 398119-27-2 appears in our catalog under these names: 3–Bromo–5–formylbenzoic acid, 3-bromo-5-formylbenzoic acid, 3-Bromo-5-formylbenzoic acid 98%, 3-Bromo-5-Formylbenzoic Acid, 95%, 95%, 3-Bromo-5-formylbenzoic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 1g, 5g, 25g, 100mg.

Structural formula: {0} (CAS {1})

3-bromo-5-formylbenzoic acid (CAS 398119-27-2) is a chemical compound with the molecular formula C8H5BrO3 and a molecular weight of 229.03 g/mol. IUPAC name: 3-bromo-5-formylbenzoic acid. InChIKey: NQFXEXFUWOVHGW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5BrO3
Molecular weight229.03 g/mol
IUPAC name3-bromo-5-formylbenzoic acid
InChIKeyNQFXEXFUWOVHGW-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1C(=O)O)Br)C=O

Computed by PubChem (NCBI)