CAS 2570190-42-8 is the registry number for 6-Bromo-4-hydroxy-3H-2-benzofuran-1-one, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-bromo-4-hydroxy-3H-2-benzofuran-1-one (CAS 2570190-42-8) is a chemical compound with the molecular formula C8H5BrO3 and a molecular weight of 229.03 g/mol. IUPAC name: 6-bromo-4-hydroxy-3H-2-benzofuran-1-one. InChIKey: DNBGQUYHYIEHFJ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO3 |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 6-bromo-4-hydroxy-3H-2-benzofuran-1-one |
| InChIKey | DNBGQUYHYIEHFJ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2O)Br)C(=O)O1 |
Computed by PubChem (NCBI)