CAS 91760-66-6 appears in our catalog under these names: 3-Bromo-4-formylbenzoic acid 97%, 3-BroMo-4-forMylbenzoic acid, 97%, 97%, 3-Bromo-4-formylbenzoic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 500mg, 100mg, 250mg.
3-bromo-4-formylbenzoic acid (CAS 91760-66-6) is a chemical compound with the molecular formula C8H5BrO3 and a molecular weight of 229.03 g/mol. IUPAC name: 3-bromo-4-formylbenzoic acid. InChIKey: GBKQIFMNYQGCEJ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO3 |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 3-bromo-4-formylbenzoic acid |
| InChIKey | GBKQIFMNYQGCEJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Br)C=O |
Computed by PubChem (NCBI)