Products 503821-93-0
CAS 503821-93-0 appears in our catalog under these names: 3-Bromo-2-formylbenzoic acid, 95%, Olaparib Impurity 68, 3-Bromo-2-formyl-benzoic acid, 3-Bromo-2-formylbenzoic acid 97%, 3-Bromo-2-formylbenzoic acid, 97%, 97%. Offered by: Combi-blocks, Chemat Brand, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, on request, 100mg.
3-bromo-2-formylbenzoic acid (CAS 503821-93-0) is a chemical compound with the molecular formula C8H5BrO3 and a molecular weight of 229.03 g/mol. IUPAC name: 3-bromo-2-formylbenzoic acid. InChIKey: VOVNLLRCBFAQGC-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO3 |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 3-bromo-2-formylbenzoic acid |
| InChIKey | VOVNLLRCBFAQGC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C=O)C(=O)O |
Computed by PubChem (NCBI)