CAS 1289208-00-9 appears in our catalog under these names: 2-Bromo-3-formylbenzoic acid, 95%, 2-Bromo-3-formylbenzoic acid, 98%, 98%, 2-BROMO-3-FORMYLBENZOIC ACID, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
2-bromo-3-formylbenzoic acid (CAS 1289208-00-9) is a chemical compound with the molecular formula C8H5BrO3 and a molecular weight of 229.03 g/mol. IUPAC name: 2-bromo-3-formylbenzoic acid. InChIKey: VBVNRCZTFKBHRM-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO3 |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 2-bromo-3-formylbenzoic acid |
| InChIKey | VBVNRCZTFKBHRM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(=O)O)Br)C=O |
Computed by PubChem (NCBI)