Products 776315-23-2
CAS 776315-23-2 appears in our catalog under these names: 4-Bromo-3-formylbenzoic acid, 95%, 4-Bromo-3-formylbenzoic acid, 97%, 4-bromo-3-formylbenzoic acid, 4-Bromo-3-formylbenzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-bromo-3-formylbenzoic acid (CAS 776315-23-2) is a chemical compound with the molecular formula C8H5BrO3 and a molecular weight of 229.03 g/mol. IUPAC name: 4-bromo-3-formylbenzoic acid. InChIKey: BCCWNHVSVOSFOT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO3 |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 4-bromo-3-formylbenzoic acid |
| InChIKey | BCCWNHVSVOSFOT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C=O)Br |
Computed by PubChem (NCBI)