cas: 50343-02-7 — see every product listed under this CAS number, including other names
3-Bromo-2-hydroxy-5-methoxybenzaldehyde 95% (CAS 50343-02-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A348554-100mg |
| cas | 50343-02-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 704.12 Pln | |
| Ambeed | 10g | 1332.69 Pln | |
| Ambeed | 25g | 3029.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A348554 |
3-bromo-2-hydroxy-5-methoxybenzaldehyde (CAS 50343-02-7) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 3-bromo-2-hydroxy-5-methoxybenzaldehyde. InChIKey: BSLKYCQDKAAGGV-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 3-bromo-2-hydroxy-5-methoxybenzaldehyde |
| InChIKey | BSLKYCQDKAAGGV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)O)C=O |
Computed by PubChem (NCBI)