cas: 116529-61-4 — see every product listed under this CAS number, including other names
3-Bromo-2-nitrobenzoic acid 95% (CAS 116529-61-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A292078-100mg |
| cas | 116529-61-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 342.56 Pln | |
| Ambeed | 5g | 1026.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A292078 |
3-bromo-2-nitrobenzoic acid (CAS 116529-61-4) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 3-bromo-2-nitrobenzoic acid. InChIKey: JAURIZJCCFDGDI-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 3-bromo-2-nitrobenzoic acid |
| InChIKey | JAURIZJCCFDGDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)