cas: 91182-50-2 — see every product listed under this CAS number, including other names
3-Bromo-2-phenylpyridine 97% (CAS 91182-50-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A376538-100mg |
| cas | 91182-50-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1093.50 Pln | |
| Ambeed | 10g | 2061.38 Pln | |
| Ambeed | 25g | 4152.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A376538 |
3-bromo-2-phenylpyridine (CAS 91182-50-2) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 3-bromo-2-phenylpyridine. InChIKey: QODMOFYNGFSWSQ-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 3-bromo-2-phenylpyridine |
| InChIKey | QODMOFYNGFSWSQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC=N2)Br |
Computed by PubChem (NCBI)