cas: 91182-50-2 — see every product listed under this CAS number, including other names
3-Bromo-2-phenylpyridine, 97%, 97% (CAS 91182-50-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114J1T-10g |
| cas | 91182-50-2 |
| size | 10g |
| availability | 33.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1355.60 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 765.20 Pln | |
| Chemat | 25g | 2776.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-bromo-2-phenylpyridine (CAS 91182-50-2) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 3-bromo-2-phenylpyridine. InChIKey: QODMOFYNGFSWSQ-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 3-bromo-2-phenylpyridine |
| InChIKey | QODMOFYNGFSWSQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC=N2)Br |
Computed by PubChem (NCBI)