cas: 52805-45-5 — see every product listed under this CAS number, including other names
3-Bromo-4-Hydroxy-5-Methoxybenzonitrile, 99%, 99% (CAS 52805-45-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114J2W-1g |
| cas | 52805-45-5 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 362.00 Pln | |
| Chemat | 10g | 664.40 Pln | |
| Chemat | 25g | 1480.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
3-bromo-4-hydroxy-5-methoxybenzonitrile (CAS 52805-45-5) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 3-bromo-4-hydroxy-5-methoxybenzonitrile. InChIKey: FHXLXRNDUJYBEQ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 3-bromo-4-hydroxy-5-methoxybenzonitrile |
| InChIKey | FHXLXRNDUJYBEQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C#N)Br)O |
Computed by PubChem (NCBI)