CAS 1196155-15-3 appears in our catalog under these names: 6-Bromo-2h-pyrano[2,3-b]pyridin-4(3h)-one, 95%, 6-Bromo-2,3-dihydro-pyrano(2,3-b)pyridin-4-one, 98%, 6-Bromo-2,3-dihydro-pyrano(2,3-b)pyridin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
6-bromo-2,3-dihydropyrano[2,3-b]pyridin-4-one (CAS 1196155-15-3) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 6-bromo-2,3-dihydropyrano[2,3-b]pyridin-4-one. InChIKey: WBLGHRGVFAGBAR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 6-bromo-2,3-dihydropyrano[2,3-b]pyridin-4-one |
| InChIKey | WBLGHRGVFAGBAR-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=C(C=N2)Br |
Computed by PubChem (NCBI)