Products 1357352-10-3
CAS 1357352-10-3 appears in our catalog under these names: 3–Bromomethyl–5–Furan–2–Yl–Isoxazole, 3-Bromomethyl-5-furan-2-yl-isoxazole, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
3-(bromomethyl)-5-(furan-2-yl)-1,2-oxazole (CAS 1357352-10-3) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 3-(bromomethyl)-5-(furan-2-yl)-1,2-oxazole. InChIKey: DTRXQDQZNJNOGX-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 3-(bromomethyl)-5-(furan-2-yl)-1,2-oxazole |
| InChIKey | DTRXQDQZNJNOGX-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC(=NO2)CBr |
Computed by PubChem (NCBI)