CAS 861106-93-6 appears in our catalog under these names: 5-Bromo-1,4-dihydro-2h-benzo[d][1,3]oxazin-2-one, 95%, 5-Bromo-1,4-dihydro-2h-benzo[d][1,3]oxazin-2-one, ≥95%, ≥95%, 5-BROMO-1,4-DIHYDRO-2H-BENZO[D][1,3]OXAZIN-2-ONE. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g.
5-bromo-1,4-dihydro-3,1-benzoxazin-2-one (CAS 861106-93-6) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 5-bromo-1,4-dihydro-3,1-benzoxazin-2-one. InChIKey: XZVJGIWTWBRGBL-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 5-bromo-1,4-dihydro-3,1-benzoxazin-2-one |
| InChIKey | XZVJGIWTWBRGBL-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2Br)NC(=O)O1 |
Computed by PubChem (NCBI)