CAS 688363-48-6 appears in our catalog under these names: 8-Bromo-2h-benzo[b][1,4]oxazin-3(4h)-one, 96%, 8-Bromo-2H-benzo(b)(1,4)oxazin-3(4H)-one, 98%, 8-Bromo-2H-1,4-benzoxazin-3(4H)-one, 8-Bromo-2H-benzo[b][1,4]oxazin-3(4H)-one 96%, 8-Bromo-4H-benzo[1,4]oxazin-3-one, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 25g, 100mg, 2.5g.
8-bromo-4H-1,4-benzoxazin-3-one (CAS 688363-48-6) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 8-bromo-4H-1,4-benzoxazin-3-one. InChIKey: FVGSWEPMUVKUDX-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 8-bromo-4H-1,4-benzoxazin-3-one |
| InChIKey | FVGSWEPMUVKUDX-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C(=CC=C2)Br |
Computed by PubChem (NCBI)