CAS 1017783-09-3 appears in our catalog under these names: 6-Bromo-1,4-dihydro-2h-3,1-benzoxazin-2-one, 95%, 6-Bromo-1,4-dihydro-2H-3,1-benzoxazin-2-one, 96%, 96%, 6-Bromo-1,4-dihydro-2H-3,1-benzoxazin-2-one, 96%, 6-Bromo-1,4-dihydro-2H-3,1-benzoxazin-2-one, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 25g, 2.5g.
6-bromo-1,4-dihydro-3,1-benzoxazin-2-one (CAS 1017783-09-3) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 6-bromo-1,4-dihydro-3,1-benzoxazin-2-one. InChIKey: SSTOTANBGDRSRF-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 6-bromo-1,4-dihydro-3,1-benzoxazin-2-one |
| InChIKey | SSTOTANBGDRSRF-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Br)NC(=O)O1 |
Computed by PubChem (NCBI)