CAS 1260672-39-6 appears in our catalog under these names: 5-Bromo-2h-benzo[b][1,4]oxazin-3(4h)-one, 95%, 5-Bromo-2H-benzo(b)(1,4)oxazin-3(4H)-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
5-bromo-4H-1,4-benzoxazin-3-one (CAS 1260672-39-6) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 5-bromo-4H-1,4-benzoxazin-3-one. InChIKey: BFWNINZPRWATHD-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 5-bromo-4H-1,4-benzoxazin-3-one |
| InChIKey | BFWNINZPRWATHD-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC=C2Br |
Computed by PubChem (NCBI)