cas: 194019-11-9 — see every product listed under this CAS number, including other names
3-Bromo-4-fluorophenylacetic Acid, >97.0%(GC)(T) (CAS 194019-11-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B2976-5G |
| cas | 194019-11-9 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 231.44 Pln | |
| TCI | 25g | 787.09 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC)(T) |
2-(3-bromo-4-fluorophenyl)acetic acid (CAS 194019-11-9) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-(3-bromo-4-fluorophenyl)acetic acid. InChIKey: XXFGIJYSXNXNAU-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-(3-bromo-4-fluorophenyl)acetic acid |
| InChIKey | XXFGIJYSXNXNAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)Br)F |
Computed by PubChem (NCBI)