cas: 98555-49-8 — see every product listed under this CAS number, including other names
3-Bromo-4-hydroxy-5-nitrobenzaldehyde, 96%, 96% (CAS 98555-49-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1178XY-250mg |
| cas | 98555-49-8 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 592.40 Pln | |
| Chemat | 5g | 2046.80 Pln | |
| Chemat | 10g | 3462.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3-bromo-4-hydroxy-5-nitrobenzaldehyde (CAS 98555-49-8) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 3-bromo-4-hydroxy-5-nitrobenzaldehyde. InChIKey: QBGJRIICMHIJJR-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 3-bromo-4-hydroxy-5-nitrobenzaldehyde |
| InChIKey | QBGJRIICMHIJJR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)Br)C=O |
Computed by PubChem (NCBI)