cas: 886498-07-3 — see every product listed under this CAS number, including other names
3-Bromo-5-(trifluoromethoxy)benzaldehyde, 97% (CAS 886498-07-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F237588-5G |
| cas | 886498-07-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 10g | 518.59 Pln | |
| Fluorochem | 25g | 1153.78 Pln | |
| Fluorochem | 100g | 3819.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-bromo-5-(trifluoromethoxy)benzaldehyde (CAS 886498-07-3) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: 3-bromo-5-(trifluoromethoxy)benzaldehyde. InChIKey: ALIVUZVZCLVJQN-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | 3-bromo-5-(trifluoromethoxy)benzaldehyde |
| InChIKey | ALIVUZVZCLVJQN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Br)C=O |
Computed by PubChem (NCBI)