CAS 398119-27-2 appears in our catalog under these names: 3–Bromo–5–formylbenzoic acid, 3-bromo-5-formylbenzoic acid, 3-Bromo-5-Formylbenzoic Acid, 95%, 95%, 3-Bromo-5-formylbenzoic acid, 95%, 3-Bromo-5-formylbenzoic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 2,5g, 100mg, 1g, 5g, 25g.
3-bromo-5-formylbenzoic acid (CAS 398119-27-2) is a chemical compound with the molecular formula C8H5BrO3 and a molecular weight of 229.03 g/mol. IUPAC name: 3-bromo-5-formylbenzoic acid. InChIKey: NQFXEXFUWOVHGW-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO3 |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 3-bromo-5-formylbenzoic acid |
| InChIKey | NQFXEXFUWOVHGW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)Br)C=O |
Computed by PubChem (NCBI)