cas: 54321-80-1 — see every product listed under this CAS number, including other names
3-Bromo-5-nitrobenzamide, ≥95%, ≥95% (CAS 54321-80-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DACC-5g |
| cas | 54321-80-1 |
| size | 5g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 770.00 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 299.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
3-bromo-5-nitrobenzamide (CAS 54321-80-1) is a chemical compound with the molecular formula C7H5BrN2O3 and a molecular weight of 245.03 g/mol. IUPAC name: 3-bromo-5-nitrobenzamide. InChIKey: WNYWPPUDAKYNIZ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O3 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 3-bromo-5-nitrobenzamide |
| InChIKey | WNYWPPUDAKYNIZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])Br)C(=O)N |
Computed by PubChem (NCBI)