cas: 49839-81-8 — see every product listed under this CAS number, including other names
3-Bromomandelic acid 95% (CAS 49839-81-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A391840-100mg |
| cas | 49839-81-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 342.56 Pln | |
| Ambeed | 250mg | 743.06 Pln | |
| Ambeed | 1g | 2066.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A391840 |
2-(3-bromophenyl)-2-hydroxyacetic acid (CAS 49839-81-8) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-(3-bromophenyl)-2-hydroxyacetic acid. InChIKey: CBEMVOYIUQADIA-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-(3-bromophenyl)-2-hydroxyacetic acid |
| InChIKey | CBEMVOYIUQADIA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(C(=O)O)O |
Computed by PubChem (NCBI)