cas: 18523-22-3 — see every product listed under this CAS number, including other names
3-Bromophenacyl Bromide, >98.0%(T) (CAS 18523-22-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B4125-5G |
| cas | 18523-22-3 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 532.88 Pln | |
| TCI | 25g | 1619.60 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
2-bromo-1-(3-bromophenyl)ethanone (CAS 18523-22-3) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 2-bromo-1-(3-bromophenyl)ethanone. InChIKey: MZBXSQBQPJWECM-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 2-bromo-1-(3-bromophenyl)ethanone |
| InChIKey | MZBXSQBQPJWECM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)CBr |
Computed by PubChem (NCBI)