cas: 18523-22-3 — see every product listed under this CAS number, including other names
3-Bromophenacyl bromide, 98% (CAS 18523-22-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011106-1G |
| cas | 18523-22-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 200.99 Pln | |
| Fluorochem | 25g | 331.15 Pln | |
| Fluorochem | 100g | 1164.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-1-(3-bromophenyl)ethanone (CAS 18523-22-3) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 2-bromo-1-(3-bromophenyl)ethanone. InChIKey: MZBXSQBQPJWECM-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 2-bromo-1-(3-bromophenyl)ethanone |
| InChIKey | MZBXSQBQPJWECM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)CBr |
Computed by PubChem (NCBI)