cas: 871329-84-9 — see every product listed under this CAS number, including other names
3-Carboxy-5-fluorophenylboronic Acid (contains varying amounts of Anhydride) (CAS 871329-84-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C3287-1G |
| cas | 871329-84-9 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 290.45 Pln | |
| TCI | 5g | 1229.64 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
3-borono-5-fluorobenzoic acid (CAS 871329-84-9) is a chemical compound with the molecular formula C7H6BFO4 and a molecular weight of 183.93 g/mol. IUPAC name: 3-borono-5-fluorobenzoic acid. InChIKey: APHPXZJIUTVQNC-UHFFFAOYSA-N.
| Molecular formula | C7H6BFO4 |
|---|---|
| Molecular weight | 183.93 g/mol |
| IUPAC name | 3-borono-5-fluorobenzoic acid |
| InChIKey | APHPXZJIUTVQNC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)C(=O)O)(O)O |
Computed by PubChem (NCBI)